C34H44N6O2 — CID 10144555
4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-(pentan-3-ylamino)pentan-2-yl]benzamide (PubChem CID 10144555) has the molecular formula C34H44N6O2 and a molecular weight of 568.77 g/mol. Its IUPAC name is 4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-(pentan-3-ylamino)pentan-2-yl]benzamide.
| Compound Name | 4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-(pentan-3-ylamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 10144555 |
| Molecular Formula | C34H44N6O2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-(pentan-3-ylamino)pentan-2-yl]benzamide |
| SMILES | CCC(CC)NCCC[C@H](NC(=O)c1ccc(CNCc2ncc[nH]2)cc1)C(=O)NC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C34H44N6O2/c1-4-28(5-2)36-19-9-14-31(34(42)39-24(3)29-13-8-11-26-10-6-7-12-30(26)29)40-33(41)27-17-15-25(16-18-27)22-35-23-32-37-20-21-38-32/h6-8,10-13,15-18,20-21,24,28,31,35-36H,4-5,9,14,19,22-23H2,1-3H3,(H,37,38)(H,39,42)(H,40,41)/t24?,31-/m0/s1 |
| InChIKey | WDWYZWMKTTUSJB-KEASEGHRSA-N |
| XLogP | 5.39 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|