C31H35N7O4 — CID 90775878
N-carbamoyl-5-[1-[[(2S)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoyl]amino]ethyl]naphthalene-1-carboxamide (PubChem CID 90775878) has the molecular formula C31H35N7O4 and a molecular weight of 569.67 g/mol. Its IUPAC name is N-carbamoyl-5-[1-[[(2S)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoyl]amino]ethyl]naphthalene-1-carboxamide.
| Compound Name | N-carbamoyl-5-[1-[[(2S)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoyl]amino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90775878 |
| Molecular Formula | C31H35N7O4 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | N-carbamoyl-5-[1-[[(2S)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoyl]amino]ethyl]naphthalene-1-carboxamide |
| SMILES | CCC[C@H](NC(=O)c1ccc(CNCc2ncc[nH]2)cc1)C(=O)NC(C)c1cccc2c(C(=O)NC(N)=O)cccc12 |
| InChI | InChI=1S/C31H35N7O4/c1-3-6-26(37-28(39)21-13-11-20(12-14-21)17-33-18-27-34-15-16-35-27)30(41)36-19(2)22-7-4-9-24-23(22)8-5-10-25(24)29(40)38-31(32)42/h4-5,7-16,19,26,33H,3,6,17-18H2,1-2H3,(H,34,35)(H,36,41)(H,37,39)(H3,32,38,40,42)/t19?,26-/m0/s1 |
| InChIKey | BNJOUQBGHHOFML-SYCQMTRVSA-N |
| XLogP | 3.44 |
| TPSA | 171.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |