C18H25N7O3 — CID 90826145
(2S)-5-(diaminomethylideneamino)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoic acid (PubChem CID 90826145) has the molecular formula C18H25N7O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 90826145 |
| Molecular Formula | C18H25N7O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[4-[(1H-imidazol-2-ylmethylamino)methyl]benzoyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccc(CNCc2ncc[nH]2)cc1)C(=O)O |
| InChI | InChI=1S/C18H25N7O3/c19-18(20)24-7-1-2-14(17(27)28)25-16(26)13-5-3-12(4-6-13)10-21-11-15-22-8-9-23-15/h3-6,8-9,14,21H,1-2,7,10-11H2,(H,22,23)(H,25,26)(H,27,28)(H4,19,20,24)/t14-/m0/s1 |
| InChIKey | CZFURIAPTZSCRR-AWEZNQCLSA-N |
| XLogP | -0.06 |
| TPSA | 171.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|