C17H28N6O6 — CID 175213637
2-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid;2-prop-2-enyl-1H-imidazole (PubChem CID 175213637) has the molecular formula C17H28N6O6 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid;2-prop-2-enyl-1H-imidazole.
| Compound Name | 2-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid;2-prop-2-enyl-1H-imidazole |
|---|---|
| PubChem CID | 175213637 |
| Molecular Formula | C17H28N6O6 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid;2-prop-2-enyl-1H-imidazole |
| SMILES | C=CCc1ncc[nH]1.NC(N)=NCCCC(NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N4O6.C6H8N2/c12-11(13)14-5-1-2-6(9(18)19)15-7(10(20)21)3-4-8(16)17;1-2-3-6-7-4-5-8-6/h6-7,15H,1-5H2,(H,16,17)(H,18,19)(H,20,21)(H4,12,13,14);2,4-5H,1,3H2,(H,7,8) |
| InChIKey | HJXAHGIVAJQOFM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 217.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|