C8H12Br2 — CID 101447232
(1S,2R,6R)-2-(dibromomethyl)bicyclo[4.1.0]heptane (PubChem CID 101447232) has the molecular formula C8H12Br2 and a molecular weight of 267.99 g/mol. Its IUPAC name is (1S,2R,6R)-2-(dibromomethyl)bicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,6R)-2-(dibromomethyl)bicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 101447232 |
| Molecular Formula | C8H12Br2 |
| Molecular Weight | 267.99 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | (1S,2R,6R)-2-(dibromomethyl)bicyclo[4.1.0]heptane |
| SMILES | BrC(Br)[C@@H]1CCC[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C8H12Br2/c9-8(10)6-3-1-2-5-4-7(5)6/h5-8H,1-4H2/t5-,6-,7+/m1/s1 |
| InChIKey | DQWNYJJRVWGKBH-QYNIQEEDSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|