C25H24N4O2 — CID 101452712
2-benzyl-5-[[4-(diethylamino)phenyl]diazenyl]isoindole-1,3-dione (PubChem CID 101452712) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-benzyl-5-[[4-(diethylamino)phenyl]diazenyl]isoindole-1,3-dione.
| Compound Name | 2-benzyl-5-[[4-(diethylamino)phenyl]diazenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101452712 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-benzyl-5-[[4-(diethylamino)phenyl]diazenyl]isoindole-1,3-dione |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-3-28(4-2)21-13-10-19(11-14-21)26-27-20-12-15-22-23(16-20)25(31)29(24(22)30)17-18-8-6-5-7-9-18/h5-16H,3-4,17H2,1-2H3/b27-26+ |
| InChIKey | NOKQUODHFJJLJA-CYYJNZCTSA-N |
| XLogP | 5.74 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|