C12H17O2S- — CID 101452755
(5S,7R)-3-methylsulfanyladamantane-1-carboxylate (PubChem CID 101452755) has the molecular formula C12H17O2S- and a molecular weight of 225.33 g/mol. Its IUPAC name is (5S,7R)-3-methylsulfanyladamantane-1-carboxylate.
| Compound Name | (5S,7R)-3-methylsulfanyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 101452755 |
| Molecular Formula | C12H17O2S- |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (5S,7R)-3-methylsulfanyladamantane-1-carboxylate |
| SMILES | CSC12C[C@H]3C[C@@H](C1)CC(C(=O)[O-])(C3)C2 |
| InChI | InChI=1S/C12H18O2S/c1-15-12-5-8-2-9(6-12)4-11(3-8,7-12)10(13)14/h8-9H,2-7H2,1H3,(H,13,14)/p-1/t8-,9+,11?,12? |
| InChIKey | UEEZWIXTZATUHK-LRSDLPTKSA-M |
| XLogP | 1.44 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |