C18H32O4Si — CID 101455401
ethyl (2Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4-methyl-3-oxohept-6-enoate (PubChem CID 101455401) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is ethyl (2Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4-methyl-3-oxohept-6-enoate.
| Compound Name | ethyl (2Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4-methyl-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 101455401 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | ethyl (2Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylidene-4-methyl-3-oxohept-6-enoate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)/C(=C/C)C(=O)OCC |
| InChI | InChI=1S/C18H32O4Si/c1-10-14(17(20)21-12-3)16(19)13(4)15(11-2)22-23(8,9)18(5,6)7/h10-11,13,15H,2,12H2,1,3-9H3/b14-10-/t13-,15+/m1/s1 |
| InChIKey | XUUUBLSJFBRJRW-GOODPXDFSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|