C13H16O3 — CID 101460016
(2R,3S,6S)-2-(hydroxymethyl)-6-(4-methylphenyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 101460016) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2R,3S,6S)-2-(hydroxymethyl)-6-(4-methylphenyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6S)-2-(hydroxymethyl)-6-(4-methylphenyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 101460016 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2R,3S,6S)-2-(hydroxymethyl)-6-(4-methylphenyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | Cc1ccc([C@@H]2C=C[C@H](O)[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C13H16O3/c1-9-2-4-10(5-3-9)12-7-6-11(15)13(8-14)16-12/h2-7,11-15H,8H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | YMIHZXFWQMSMLW-RWMBFGLXSA-N |
| XLogP | 1.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|