C19H23N — CID 101460629
5,7-dimethyl-2-(4-methylphenyl)-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 101460629) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 5,7-dimethyl-2-(4-methylphenyl)-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 5,7-dimethyl-2-(4-methylphenyl)-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 101460629 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 5,7-dimethyl-2-(4-methylphenyl)-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | Cc1ccc(N2CCC(C)c3cc(C)ccc3C2)cc1 |
| InChI | InChI=1S/C19H23N/c1-14-5-8-18(9-6-14)20-11-10-16(3)19-12-15(2)4-7-17(19)13-20/h4-9,12,16H,10-11,13H2,1-3H3 |
| InChIKey | SESCLCRYZDGDLT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|