C19H26BrNO5Si — CID 101463713
butyl (2R,6S)-4-bromo-2-(3-nitrophenyl)-5-trimethylsilyl-3,6-dihydro-2H-pyran-6-carboxylate (PubChem CID 101463713) has the molecular formula C19H26BrNO5Si and a molecular weight of 456.41 g/mol. Its IUPAC name is butyl (2R,6S)-4-bromo-2-(3-nitrophenyl)-5-trimethylsilyl-3,6-dihydro-2H-pyran-6-carboxylate.
| Compound Name | butyl (2R,6S)-4-bromo-2-(3-nitrophenyl)-5-trimethylsilyl-3,6-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 101463713 |
| Molecular Formula | C19H26BrNO5Si |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | butyl (2R,6S)-4-bromo-2-(3-nitrophenyl)-5-trimethylsilyl-3,6-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1O[C@@H](c2cccc([N+](=O)[O-])c2)CC(Br)=C1[Si](C)(C)C |
| InChI | InChI=1S/C19H26BrNO5Si/c1-5-6-10-25-19(22)17-18(27(2,3)4)15(20)12-16(26-17)13-8-7-9-14(11-13)21(23)24/h7-9,11,16-17H,5-6,10,12H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | SDCQRVGDPFBXGY-IAGOWNOFSA-N |
| XLogP | 5.29 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|