C54H74N6O6 — CID 139069924
methanol;2,8,12,18-tetrabutyl-3,7,13,17-tetramethyl-5,15-bis(3-nitrophenyl)-5,10,15,20,21,22,23,24-octahydroporphyrin (PubChem CID 139069924) has the molecular formula C54H74N6O6 and a molecular weight of 903.22 g/mol. Its IUPAC name is methanol;2,8,12,18-tetrabutyl-3,7,13,17-tetramethyl-5,15-bis(3-nitrophenyl)-5,10,15,20,21,22,23,24-octahydroporphyrin.
| Compound Name | methanol;2,8,12,18-tetrabutyl-3,7,13,17-tetramethyl-5,15-bis(3-nitrophenyl)-5,10,15,20,21,22,23,24-octahydroporphyrin |
|---|---|
| PubChem CID | 139069924 |
| Molecular Formula | C54H74N6O6 |
| Molecular Weight | 903.22 g/mol |
| Exact Mass | 902.57 |
| IUPAC Name | methanol;2,8,12,18-tetrabutyl-3,7,13,17-tetramethyl-5,15-bis(3-nitrophenyl)-5,10,15,20,21,22,23,24-octahydroporphyrin |
| SMILES | CCCCc1c2[nH]c(c1C)C(c1cccc([N+](=O)[O-])c1)c1[nH]c(c(CCCC)c1C)Cc1[nH]c(c(C)c1CCCC)C(c1cccc([N+](=O)[O-])c1)c1[nH]c(c(CCCC)c1C)C2.CO.CO |
| InChI | InChI=1S/C52H66N6O4.2CH4O/c1-9-13-23-39-31(5)49-47(35-19-17-21-37(27-35)57(59)60)50-33(7)41(25-15-11-3)45(55-50)30-46-42(26-16-12-4)34(8)52(56-46)48(36-20-18-22-38(28-36)58(61)62)51-32(6)40(24-14-10-2)44(54-51)29-43(39)53-49;2*1-2/h17-22,27-28,47-48,53-56H,9-16,23-26,29-30H2,1-8H3;2*2H,1H3 |
| InChIKey | WNJGUHOKOQSZLC-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 189.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.22 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|