C25H31N3O7 — CID 141304708
dimethyl 1-[(3-butyl-2H-1,3-oxazol-5-yl)methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 141304708) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is dimethyl 1-[(3-butyl-2H-1,3-oxazol-5-yl)methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 1-[(3-butyl-2H-1,3-oxazol-5-yl)methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 141304708 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | dimethyl 1-[(3-butyl-2H-1,3-oxazol-5-yl)methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCCCN1C=C(CN2C(C)=C(C(=O)OC)C(c3cccc([N+](=O)[O-])c3)C(C(=O)OC)=C2C)OC1 |
| InChI | InChI=1S/C25H31N3O7/c1-6-7-11-26-13-20(35-15-26)14-27-16(2)21(24(29)33-4)23(22(17(27)3)25(30)34-5)18-9-8-10-19(12-18)28(31)32/h8-10,12-13,23H,6-7,11,14-15H2,1-5H3 |
| InChIKey | VQPCWGQMJLXTMS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|