C17H13ClN2OS — CID 101468221
[4-(4-chlorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone (PubChem CID 101468221) has the molecular formula C17H13ClN2OS and a molecular weight of 328.82 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone.
| Compound Name | [4-(4-chlorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101468221 |
| Molecular Formula | C17H13ClN2OS |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | [4-(4-chlorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
| SMILES | O=C(C1=CNC(=S)NC1c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN2OS/c18-13-8-6-11(7-9-13)15-14(10-19-17(22)20-15)16(21)12-4-2-1-3-5-12/h1-10,15H,(H2,19,20,22) |
| InChIKey | KVDQFAHIEIACDG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|