About lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide
lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide (PubChem CID 101471144) has the molecular formula C30H32LiN2P
and a molecular weight of 458.52 g/mol. Its IUPAC name is lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide.
Molecular Properties
| Compound Name | lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide |
| PubChem CID | 101471144 |
| Molecular Formula | C30H32LiN2P |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide |
| SMILES | CC(C)c1ccc(N=P([N-]c2ccc(C(C)C)cc2)(c2ccccc2)c2ccccc2)cc1.[Li+] |
| InChI | InChI=1S/C30H32N2P.Li/c1-23(2)25-15-19-27(20-16-25)31-33(29-11-7-5-8-12-29,30-13-9-6-10-14-30)32-28-21-17-26(18-22-28)24(3)4;/h5-24H,1-4H3;/q-1;+1 |
| InChIKey | FGXLJWPGPVGUSD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide?
The IUPAC name of lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide (CID 101471144) is lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide.
What is the SMILES notation for lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide?
The canonical SMILES for lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide is CC(C)c1ccc(N=P([N-]c2ccc(C(C)C)cc2)(c2ccccc2)c2ccccc2)cc1.[Li+].
What is the InChIKey of lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide?
The InChIKey is FGXLJWPGPVGUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2P.Li/c1-23(2)25-15-19-27(20-16-25)31-33(29-11-7-5-8-12-29,30-13-9-6-10-14-30)32-28-21-17-26(18-22-28)24(3)4;/h5-24H,1-4H3;/q-1;+1.
What are the key properties of lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide?
lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide has a molecular weight of 458.52 g/mol, XLogP of 6.04, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium [diphenyl-(4-propan-2-ylphenyl)imino-λ5-phosphanyl]-(4-propan-2-ylphenyl)azanide is sourced from PubChem (CID 101471144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).