C12H14N4O4 — CID 101478671
diethyl 1-(1H-1,2,4-triazol-5-yl)pyrrole-3,4-dicarboxylate (PubChem CID 101478671) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is diethyl 1-(1H-1,2,4-triazol-5-yl)pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 1-(1H-1,2,4-triazol-5-yl)pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101478671 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | diethyl 1-(1H-1,2,4-triazol-5-yl)pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1cn(-c2ncn[nH]2)cc1C(=O)OCC |
| InChI | InChI=1S/C12H14N4O4/c1-3-19-10(17)8-5-16(12-13-7-14-15-12)6-9(8)11(18)20-4-2/h5-7H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | PQLLOTIYANPDEH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |