C19H22O4 — CID 101481582
2,2-dimethyl-5-[4-methyl-1-(4-methylphenyl)pent-1-yn-3-yl]-1,3-dioxane-4,6-dione (PubChem CID 101481582) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-methyl-1-(4-methylphenyl)pent-1-yn-3-yl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[4-methyl-1-(4-methylphenyl)pent-1-yn-3-yl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 101481582 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2,2-dimethyl-5-[4-methyl-1-(4-methylphenyl)pent-1-yn-3-yl]-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccc(C#CC(C(C)C)C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C19H22O4/c1-12(2)15(11-10-14-8-6-13(3)7-9-14)16-17(20)22-19(4,5)23-18(16)21/h6-9,12,15-16H,1-5H3 |
| InChIKey | FPIWJVYVFXNACM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|