C21H23NO4 — CID 132572303
5-[[4-(dimethylamino)phenyl]-phenylmethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 132572303) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]-phenylmethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[4-(dimethylamino)phenyl]-phenylmethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 132572303 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]-phenylmethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CN(C)c1ccc(C(c2ccccc2)C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-21(2)25-19(23)18(20(24)26-21)17(14-8-6-5-7-9-14)15-10-12-16(13-11-15)22(3)4/h5-13,17-18H,1-4H3 |
| InChIKey | YZOMESCRXDOLSX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|