C10H13NSe2 — CID 101482918
3,7-diselena-13-azabicyclo[7.3.1]trideca-1(13),9,11-triene (PubChem CID 101482918) has the molecular formula C10H13NSe2 and a molecular weight of 305.14 g/mol. Its IUPAC name is 3,7-diselena-13-azabicyclo[7.3.1]trideca-1(13),9,11-triene.
| Compound Name | 3,7-diselena-13-azabicyclo[7.3.1]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 101482918 |
| Molecular Formula | C10H13NSe2 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | 3,7-diselena-13-azabicyclo[7.3.1]trideca-1(13),9,11-triene |
| SMILES | c1cc2nc(c1)C[Se]CCC[Se]C2 |
| InChI | InChI=1S/C10H13NSe2/c1-3-9-7-12-5-2-6-13-8-10(4-1)11-9/h1,3-4H,2,5-8H2 |
| InChIKey | SFOXCQPEKFLVAU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|