C20H19N3O5 — CID 101483072
(2R,6'S)-6'-benzyl-4-methoxy-7-nitrospiro[1,3-dihydroindene-2,3'-piperazine]-2',5'-dione (PubChem CID 101483072) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is (2R,6'S)-6'-benzyl-4-methoxy-7-nitrospiro[1,3-dihydroindene-2,3'-piperazine]-2',5'-dione.
| Compound Name | (2R,6'S)-6'-benzyl-4-methoxy-7-nitrospiro[1,3-dihydroindene-2,3'-piperazine]-2',5'-dione |
|---|---|
| PubChem CID | 101483072 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (2R,6'S)-6'-benzyl-4-methoxy-7-nitrospiro[1,3-dihydroindene-2,3'-piperazine]-2',5'-dione |
| SMILES | COc1ccc([N+](=O)[O-])c2c1C[C@@]1(C2)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C20H19N3O5/c1-28-17-8-7-16(23(26)27)13-10-20(11-14(13)17)19(25)21-15(18(24)22-20)9-12-5-3-2-4-6-12/h2-8,15H,9-11H2,1H3,(H,21,25)(H,22,24)/t15-,20+/m0/s1 |
| InChIKey | OTDLDHRNVBNRPC-MGPUTAFESA-N |
| XLogP | 1.30 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|