C48H48N8 — CID 101485819
4-[10,15,20-tris(4-aminophenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]aniline (PubChem CID 101485819) has the molecular formula C48H48N8 and a molecular weight of 736.97 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-aminophenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]aniline.
| Compound Name | 4-[10,15,20-tris(4-aminophenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 101485819 |
| Molecular Formula | C48H48N8 |
| Molecular Weight | 736.97 g/mol |
| Exact Mass | 736.40 |
| IUPAC Name | 4-[10,15,20-tris(4-aminophenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]aniline |
| SMILES | CC1(c2ccc(N)cc2)c2ccc([nH]2)C(C)(c2ccc(N)cc2)c2ccc([nH]2)C(C)(c2ccc(N)cc2)c2ccc([nH]2)C(C)(c2ccc(N)cc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C48H48N8/c1-45(29-5-13-33(49)14-6-29)37-21-23-39(53-37)46(2,30-7-15-34(50)16-8-30)41-25-27-43(55-41)48(4,32-11-19-36(52)20-12-32)44-28-26-42(56-44)47(3,40-24-22-38(45)54-40)31-9-17-35(51)18-10-31/h5-28,53-56H,49-52H2,1-4H3 |
| InChIKey | WQMBWJJFLXKOOR-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.97 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|