About 2-ethylsulfanylaniline
2-ethylsulfanylaniline (PubChem CID 10149009) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-ethylsulfanylaniline.
Molecular Properties
| Compound Name | 2-ethylsulfanylaniline |
| PubChem CID | 10149009 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2-ethylsulfanylaniline |
| SMILES | CCSc1ccccc1N |
| InChI | InChI=1S/C8H11NS/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2,9H2,1H3 |
| InChIKey | OXFMPJRLJLBBRQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylaniline?
The IUPAC name of 2-ethylsulfanylaniline (CID 10149009) is 2-ethylsulfanylaniline.
What is the SMILES notation for 2-ethylsulfanylaniline?
The canonical SMILES for 2-ethylsulfanylaniline is CCSc1ccccc1N.
What is the InChIKey of 2-ethylsulfanylaniline?
The InChIKey is OXFMPJRLJLBBRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2,9H2,1H3.
What are the key properties of 2-ethylsulfanylaniline?
2-ethylsulfanylaniline has a molecular weight of 153.25 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylaniline is sourced from PubChem (CID 10149009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).