C15H18N2OS — CID 10149352
2-(3-butoxy-1-benzothiophen-2-yl)-4,5-dihydro-1H-imidazole (PubChem CID 10149352) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-(3-butoxy-1-benzothiophen-2-yl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(3-butoxy-1-benzothiophen-2-yl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 10149352 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(3-butoxy-1-benzothiophen-2-yl)-4,5-dihydro-1H-imidazole |
| SMILES | CCCCOc1c(C2=NCCN2)sc2ccccc12 |
| InChI | InChI=1S/C15H18N2OS/c1-2-3-10-18-13-11-6-4-5-7-12(11)19-14(13)15-16-8-9-17-15/h4-7H,2-3,8-10H2,1H3,(H,16,17) |
| InChIKey | NTKKVDOXEQPHBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|