C15H15BrO — CID 101493566
(2S,10aR)-2-bromo-3,9,10,10a-tetrahydro-1H-phenanthrene-2-carbaldehyde (PubChem CID 101493566) has the molecular formula C15H15BrO and a molecular weight of 291.19 g/mol. Its IUPAC name is (2S,10aR)-2-bromo-3,9,10,10a-tetrahydro-1H-phenanthrene-2-carbaldehyde.
| Compound Name | (2S,10aR)-2-bromo-3,9,10,10a-tetrahydro-1H-phenanthrene-2-carbaldehyde |
|---|---|
| PubChem CID | 101493566 |
| Molecular Formula | C15H15BrO |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (2S,10aR)-2-bromo-3,9,10,10a-tetrahydro-1H-phenanthrene-2-carbaldehyde |
| SMILES | O=C[C@]1(Br)CC=C2c3ccccc3CC[C@@H]2C1 |
| InChI | InChI=1S/C15H15BrO/c16-15(10-17)8-7-14-12(9-15)6-5-11-3-1-2-4-13(11)14/h1-4,7,10,12H,5-6,8-9H2/t12-,15+/m1/s1 |
| InChIKey | XSJFRJJGBIKSTP-DOMZBBRYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|