C20H17NO3 — CID 101495209
5-(3,4-dimethoxyphenyl)-2-[2-(4-methylphenyl)ethynyl]-1,3-oxazole (PubChem CID 101495209) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-[2-(4-methylphenyl)ethynyl]-1,3-oxazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-[2-(4-methylphenyl)ethynyl]-1,3-oxazole |
|---|---|
| PubChem CID | 101495209 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-[2-(4-methylphenyl)ethynyl]-1,3-oxazole |
| SMILES | COc1ccc(-c2cnc(C#Cc3ccc(C)cc3)o2)cc1OC |
| InChI | InChI=1S/C20H17NO3/c1-14-4-6-15(7-5-14)8-11-20-21-13-19(24-20)16-9-10-17(22-2)18(12-16)23-3/h4-7,9-10,12-13H,1-3H3 |
| InChIKey | KIBFQSMKRGSEGK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|