C15H13N3O4 — CID 10149535
3-[4-(3-aminophenoxy)phenyl]-5-methoxy-1,3,4-oxadiazol-2-one (PubChem CID 10149535) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-[4-(3-aminophenoxy)phenyl]-5-methoxy-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[4-(3-aminophenoxy)phenyl]-5-methoxy-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 10149535 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[4-(3-aminophenoxy)phenyl]-5-methoxy-1,3,4-oxadiazol-2-one |
| SMILES | COc1nn(-c2ccc(Oc3cccc(N)c3)cc2)c(=O)o1 |
| InChI | InChI=1S/C15H13N3O4/c1-20-14-17-18(15(19)22-14)11-5-7-12(8-6-11)21-13-4-2-3-10(16)9-13/h2-9H,16H2,1H3 |
| InChIKey | AKTFIWLRUXKEBM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|