C16H10F2N2O5 — CID 157215637
[4-[5-(2,4-difluorophenoxy)-2-oxo-1,3,4-oxadiazol-3-yl]phenyl] acetate (PubChem CID 157215637) has the molecular formula C16H10F2N2O5 and a molecular weight of 348.26 g/mol. Its IUPAC name is [4-[5-(2,4-difluorophenoxy)-2-oxo-1,3,4-oxadiazol-3-yl]phenyl] acetate.
| Compound Name | [4-[5-(2,4-difluorophenoxy)-2-oxo-1,3,4-oxadiazol-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 157215637 |
| Molecular Formula | C16H10F2N2O5 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [4-[5-(2,4-difluorophenoxy)-2-oxo-1,3,4-oxadiazol-3-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-n2nc(Oc3ccc(F)cc3F)oc2=O)cc1 |
| InChI | InChI=1S/C16H10F2N2O5/c1-9(21)23-12-5-3-11(4-6-12)20-16(22)25-15(19-20)24-14-7-2-10(17)8-13(14)18/h2-8H,1H3 |
| InChIKey | HIWAIEONXLZFNI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|