C12H13F2NO2 — CID 174520339
(2,4-difluorophenyl) 3-(dimethylamino)-2-methylprop-2-enoate (PubChem CID 174520339) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2,4-difluorophenyl) 3-(dimethylamino)-2-methylprop-2-enoate.
| Compound Name | (2,4-difluorophenyl) 3-(dimethylamino)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174520339 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2,4-difluorophenyl) 3-(dimethylamino)-2-methylprop-2-enoate |
| SMILES | CC(=CN(C)C)C(=O)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2NO2/c1-8(7-15(2)3)12(16)17-11-5-4-9(13)6-10(11)14/h4-7H,1-3H3 |
| InChIKey | KOFYFCMLMRCPNN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|