C17H14ClF2NO2 — CID 121305738
(E)-2-(4-chlorophenoxy)-1-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one (PubChem CID 121305738) has the molecular formula C17H14ClF2NO2 and a molecular weight of 337.75 g/mol. Its IUPAC name is (E)-2-(4-chlorophenoxy)-1-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one.
| Compound Name | (E)-2-(4-chlorophenoxy)-1-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 121305738 |
| Molecular Formula | C17H14ClF2NO2 |
| Molecular Weight | 337.75 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (E)-2-(4-chlorophenoxy)-1-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| SMILES | CN(C)/C=C(/Oc1ccc(Cl)cc1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14ClF2NO2/c1-21(2)10-16(23-13-6-3-11(18)4-7-13)17(22)14-8-5-12(19)9-15(14)20/h3-10H,1-2H3/b16-10+ |
| InChIKey | LOTORQUICGNYLF-MHWRWJLKSA-N |
| XLogP | 4.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.75 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|