C13H17F2N2+ — CID 84713971
[(E)-2-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium (PubChem CID 84713971) has the molecular formula C13H17F2N2+ and a molecular weight of 239.29 g/mol. Its IUPAC name is [(E)-2-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium.
| Compound Name | [(E)-2-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 84713971 |
| Molecular Formula | C13H17F2N2+ |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | [(E)-2-(2,4-difluorophenyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium |
| SMILES | CN(C)/C=C(/C=[N+](C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2N2/c1-16(2)8-10(9-17(3)4)12-6-5-11(14)7-13(12)15/h5-9H,1-4H3/q+1 |
| InChIKey | LCDHUAWVVGTUJF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|