C12H18O2 — CID 101496610
(3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalene-2-carbaldehyde (PubChem CID 101496610) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalene-2-carbaldehyde.
| Compound Name | (3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalene-2-carbaldehyde |
|---|---|
| PubChem CID | 101496610 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalene-2-carbaldehyde |
| SMILES | CO[C@H]1C[C@@H]2[C@@H](C=C(C=O)C2(C)C)C1 |
| InChI | InChI=1S/C12H18O2/c1-12(2)9(7-13)4-8-5-10(14-3)6-11(8)12/h4,7-8,10-11H,5-6H2,1-3H3/t8-,10+,11+/m0/s1 |
| InChIKey | ZJHKYZJTJKZJEM-JMJZKYOTSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|