C48H52O7 — CID 101496779
(2S,3R,4R,5R,6S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-4-yl]methyl]oxane (PubChem CID 101496779) has the molecular formula C48H52O7 and a molecular weight of 740.94 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-4-yl]methyl]oxane.
| Compound Name | (2S,3R,4R,5R,6S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-4-yl]methyl]oxane |
|---|---|
| PubChem CID | 101496779 |
| Molecular Formula | C48H52O7 |
| Molecular Weight | 740.94 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3S,4R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-4-yl]methyl]oxane |
| SMILES | C[C@@H]1O[C@@H](C[C@@H]2C=CO[C@H](COCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H52O7/c1-36-45(51-31-38-19-9-3-10-20-38)48(54-34-41-25-15-6-16-26-41)47(53-33-40-23-13-5-14-24-40)43(55-36)29-42-27-28-50-44(35-49-30-37-17-7-2-8-18-37)46(42)52-32-39-21-11-4-12-22-39/h2-28,36,42-48H,29-35H2,1H3/t36-,42-,43-,44+,45+,46-,47+,48+/m0/s1 |
| InChIKey | VXEOYETZBBBLQO-ZMNPWEKGSA-N |
| XLogP | 9.25 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.94 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |