C20H21NO3 — CID 101498513
(1R,2R,3S,5R,6S,9S,11R)-3,5-dimethyl-6-phenyl-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-4,8-dione (PubChem CID 101498513) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (1R,2R,3S,5R,6S,9S,11R)-3,5-dimethyl-6-phenyl-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-4,8-dione.
| Compound Name | (1R,2R,3S,5R,6S,9S,11R)-3,5-dimethyl-6-phenyl-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-4,8-dione |
|---|---|
| PubChem CID | 101498513 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (1R,2R,3S,5R,6S,9S,11R)-3,5-dimethyl-6-phenyl-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-4,8-dione |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@@H](c2ccccc2)N2C(=O)[C@H]3C[C@@H]4C=C[C@]3(O4)[C@@H]12 |
| InChI | InChI=1S/C20H21NO3/c1-11-16(13-6-4-3-5-7-13)21-18(12(2)17(11)22)20-9-8-14(24-20)10-15(20)19(21)23/h3-9,11-12,14-16,18H,10H2,1-2H3/t11-,12-,14+,15-,16+,18-,20-/m1/s1 |
| InChIKey | ZFPRUZCUZMAEBG-JQRQHIIWSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|