C24H26O4 — CID 10156519
(E)-3-[5-[2-hydroxy-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]but-2-enoic acid (PubChem CID 10156519) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-3-[5-[2-hydroxy-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]but-2-enoic acid.
| Compound Name | (E)-3-[5-[2-hydroxy-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 10156519 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (E)-3-[5-[2-hydroxy-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1cc2cc(-c3cc(C(C)C)cc(C(C)C)c3O)ccc2o1 |
| InChI | InChI=1S/C24H26O4/c1-13(2)17-10-19(14(3)4)24(27)20(11-17)16-6-7-21-18(9-16)12-22(28-21)15(5)8-23(25)26/h6-14,27H,1-5H3,(H,25,26)/b15-8+ |
| InChIKey | FCYDGDRRCGUFPN-OVCLIPMQSA-N |
| XLogP | 6.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|