C29H36N4O5 — CID 10164965
ethyl 2-[3-(dimethylamino)propoxy]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]quinoline-3-carboxylate (PubChem CID 10164965) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is ethyl 2-[3-(dimethylamino)propoxy]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]quinoline-3-carboxylate.
| Compound Name | ethyl 2-[3-(dimethylamino)propoxy]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 10164965 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | ethyl 2-[3-(dimethylamino)propoxy]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(OCCCN(C)C)nc2ccccc2c1N1CCN(C(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C29H36N4O5/c1-5-37-29(35)25-26(23-9-6-7-10-24(23)30-27(25)38-20-8-15-31(2)3)32-16-18-33(19-17-32)28(34)21-11-13-22(36-4)14-12-21/h6-7,9-14H,5,8,15-20H2,1-4H3 |
| InChIKey | NZDBRWPAQHTLGX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|