C26H29Cl2N5O4 — CID 58707239
(3,4-dichlorophenyl)-[4-[2-[3-(dimethylamino)propoxy]-6-methyl-3-nitroquinolin-4-yl]piperazin-1-yl]methanone (PubChem CID 58707239) has the molecular formula C26H29Cl2N5O4 and a molecular weight of 546.46 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-[2-[3-(dimethylamino)propoxy]-6-methyl-3-nitroquinolin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-[2-[3-(dimethylamino)propoxy]-6-methyl-3-nitroquinolin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 58707239 |
| Molecular Formula | C26H29Cl2N5O4 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-[2-[3-(dimethylamino)propoxy]-6-methyl-3-nitroquinolin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc2nc(OCCCN(C)C)c([N+](=O)[O-])c(N3CCN(C(=O)c4ccc(Cl)c(Cl)c4)CC3)c2c1 |
| InChI | InChI=1S/C26H29Cl2N5O4/c1-17-5-8-22-19(15-17)23(24(33(35)36)25(29-22)37-14-4-9-30(2)3)31-10-12-32(13-11-31)26(34)18-6-7-20(27)21(28)16-18/h5-8,15-16H,4,9-14H2,1-3H3 |
| InChIKey | LHLZAIAYDHQDSQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|