C28H37N7O5 — CID 142187939
aminomethyl 4-[4-(4-aminooxybenzoyl)piperazin-1-yl]-6-methyl-2-[3-[methyl(methylamino)amino]propoxy]quinoline-3-carboxylate (PubChem CID 142187939) has the molecular formula C28H37N7O5 and a molecular weight of 551.65 g/mol. Its IUPAC name is aminomethyl 4-[4-(4-aminooxybenzoyl)piperazin-1-yl]-6-methyl-2-[3-[methyl(methylamino)amino]propoxy]quinoline-3-carboxylate.
| Compound Name | aminomethyl 4-[4-(4-aminooxybenzoyl)piperazin-1-yl]-6-methyl-2-[3-[methyl(methylamino)amino]propoxy]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 142187939 |
| Molecular Formula | C28H37N7O5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | aminomethyl 4-[4-(4-aminooxybenzoyl)piperazin-1-yl]-6-methyl-2-[3-[methyl(methylamino)amino]propoxy]quinoline-3-carboxylate |
| SMILES | CNN(C)CCCOc1nc2ccc(C)cc2c(N2CCN(C(=O)c3ccc(ON)cc3)CC2)c1C(=O)OCN |
| InChI | InChI=1S/C28H37N7O5/c1-19-5-10-23-22(17-19)25(24(28(37)39-18-29)26(32-23)38-16-4-11-33(3)31-2)34-12-14-35(15-13-34)27(36)20-6-8-21(40-30)9-7-20/h5-10,17,31H,4,11-16,18,29-30H2,1-3H3 |
| InChIKey | FRDQRCKHWZAUIV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|