C27H30Cl3N5O4 — CID 142187929
ethyl 6-chloro-4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-[3-(2-methylhydrazinyl)propoxy]quinoline-3-carboxylate (PubChem CID 142187929) has the molecular formula C27H30Cl3N5O4 and a molecular weight of 594.93 g/mol. Its IUPAC name is ethyl 6-chloro-4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-[3-(2-methylhydrazinyl)propoxy]quinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-[3-(2-methylhydrazinyl)propoxy]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 142187929 |
| Molecular Formula | C27H30Cl3N5O4 |
| Molecular Weight | 594.93 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | ethyl 6-chloro-4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-[3-(2-methylhydrazinyl)propoxy]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(OCCCNNC)nc2ccc(Cl)cc2c1N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C27H30Cl3N5O4/c1-3-38-27(37)23-24(19-16-18(28)6-8-22(19)33-25(23)39-14-4-9-32-31-2)34-10-12-35(13-11-34)26(36)17-5-7-20(29)21(30)15-17/h5-8,15-16,31-32H,3-4,9-14H2,1-2H3 |
| InChIKey | KHFZLRRCVPAWQK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|