C7H17N2O4P — CID 10176883
hydroxy-[3-(trimethylazaniumyl)propylcarbamoyl]phosphinate (PubChem CID 10176883) has the molecular formula C7H17N2O4P and a molecular weight of 224.20 g/mol. Its IUPAC name is hydroxy-[3-(trimethylazaniumyl)propylcarbamoyl]phosphinate.
| Compound Name | hydroxy-[3-(trimethylazaniumyl)propylcarbamoyl]phosphinate |
|---|---|
| PubChem CID | 10176883 |
| Molecular Formula | C7H17N2O4P |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | hydroxy-[3-(trimethylazaniumyl)propylcarbamoyl]phosphinate |
| SMILES | C[N+](C)(C)CCCNC(=O)P(=O)([O-])O |
| InChI | InChI=1S/C7H17N2O4P/c1-9(2,3)6-4-5-8-7(10)14(11,12)13/h4-6H2,1-3H3,(H2-,8,10,11,12,13) |
| InChIKey | UXFZZZAFENASIB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|