C18H19NO7S — CID 10178664
(2R)-2-amino-3-[[(2S,4R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]sulfanyl]propanoic acid (PubChem CID 10178664) has the molecular formula C18H19NO7S and a molecular weight of 393.42 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2S,4R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]sulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2S,4R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10178664 |
| Molecular Formula | C18H19NO7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (2R)-2-amino-3-[[(2S,4R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]sulfanyl]propanoic acid |
| SMILES | N[C@@H](CS[C@@H]1C[C@@H](c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c21)C(=O)O |
| InChI | InChI=1S/C18H19NO7S/c19-10(18(24)25)7-27-16-6-14(8-1-2-11(21)12(22)3-8)26-15-5-9(20)4-13(23)17(15)16/h1-5,10,14,16,20-23H,6-7,19H2,(H,24,25)/t10-,14-,16+/m0/s1 |
| InChIKey | JAIOEOCQDNQHEL-JMPLFQLZSA-N |
| XLogP | 2.22 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|