C21H29N2O5P — CID 10180426
4-[(E)-1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethenyl]-2-methoxy-6-methylphenol (PubChem CID 10180426) has the molecular formula C21H29N2O5P and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-[(E)-1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethenyl]-2-methoxy-6-methylphenol.
| Compound Name | 4-[(E)-1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethenyl]-2-methoxy-6-methylphenol |
|---|---|
| PubChem CID | 10180426 |
| Molecular Formula | C21H29N2O5P |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[(E)-1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethenyl]-2-methoxy-6-methylphenol |
| SMILES | CCOP(=O)(OCC)/C(=C/Nc1ccc(C)nc1C)c1cc(C)c(O)c(OC)c1 |
| InChI | InChI=1S/C21H29N2O5P/c1-7-27-29(25,28-8-2)20(13-22-18-10-9-15(4)23-16(18)5)17-11-14(3)21(24)19(12-17)26-6/h9-13,22,24H,7-8H2,1-6H3/b20-13+ |
| InChIKey | AELIOLKSBJBLSI-DEDYPNTBSA-N |
| XLogP | 5.40 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|