C21H31N2O6P — CID 87971475
5-[2-diethoxyphosphoryl-1-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2,3-dimethoxyphenol (PubChem CID 87971475) has the molecular formula C21H31N2O6P and a molecular weight of 438.46 g/mol. Its IUPAC name is 5-[2-diethoxyphosphoryl-1-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2,3-dimethoxyphenol.
| Compound Name | 5-[2-diethoxyphosphoryl-1-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 87971475 |
| Molecular Formula | C21H31N2O6P |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 5-[2-diethoxyphosphoryl-1-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2,3-dimethoxyphenol |
| SMILES | CCOP(=O)(CC(Nc1ccc(C)nc1C)c1cc(O)c(OC)c(OC)c1)OCC |
| InChI | InChI=1S/C21H31N2O6P/c1-7-28-30(25,29-8-2)13-18(23-17-10-9-14(3)22-15(17)4)16-11-19(24)21(27-6)20(12-16)26-5/h9-12,18,23-24H,7-8,13H2,1-6H3 |
| InChIKey | XYEGVCUSPUKQIE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|