C26H43N2O5PSi — CID 87972126
N-[1-[3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-methylphenyl]-2-diethoxyphosphorylethyl]-6-methylpyridin-3-amine (PubChem CID 87972126) has the molecular formula C26H43N2O5PSi and a molecular weight of 522.70 g/mol. Its IUPAC name is N-[1-[3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-methylphenyl]-2-diethoxyphosphorylethyl]-6-methylpyridin-3-amine.
| Compound Name | N-[1-[3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-methylphenyl]-2-diethoxyphosphorylethyl]-6-methylpyridin-3-amine |
|---|---|
| PubChem CID | 87972126 |
| Molecular Formula | C26H43N2O5PSi |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-[1-[3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-methylphenyl]-2-diethoxyphosphorylethyl]-6-methylpyridin-3-amine |
| SMILES | CCOP(=O)(CC(Nc1ccc(C)nc1)c1cc(OC)c(C)c(O[Si](C)(C)C(C)(C)C)c1)OCC |
| InChI | InChI=1S/C26H43N2O5PSi/c1-11-31-34(29,32-12-2)18-23(28-22-14-13-19(3)27-17-22)21-15-24(30-8)20(4)25(16-21)33-35(9,10)26(5,6)7/h13-17,23,28H,11-12,18H2,1-10H3 |
| InChIKey | RXRWLPLOVHRGIK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|