C20H29N2O5P — CID 10294875
4-[1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2-methoxyphenol (PubChem CID 10294875) has the molecular formula C20H29N2O5P and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2-methoxyphenol.
| Compound Name | 4-[1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 10294875 |
| Molecular Formula | C20H29N2O5P |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-[1-diethoxyphosphoryl-2-[(2,6-dimethyl-3-pyridinyl)amino]ethyl]-2-methoxyphenol |
| SMILES | CCOP(=O)(OCC)C(CNc1ccc(C)nc1C)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H29N2O5P/c1-6-26-28(24,27-7-2)20(16-9-11-18(23)19(12-16)25-5)13-21-17-10-8-14(3)22-15(17)4/h8-12,20-21,23H,6-7,13H2,1-5H3 |
| InChIKey | CCWWHJRGFKEYBA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|