C28H31N5O9 — CID 10188481
N-[[(5aR,6aS,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide (PubChem CID 10188481) has the molecular formula C28H31N5O9 and a molecular weight of 581.58 g/mol. Its IUPAC name is N-[[(5aR,6aS,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[[(5aR,6aS,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 10188481 |
| Molecular Formula | C28H31N5O9 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | N-[[(5aR,6aS,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)c2ccno2)c(O)c2c1C[C@H]1C[C@H]3C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H31N5O9/c1-32(2)15-9-12(10-30-27(40)16-5-6-31-42-16)21(34)18-13(15)7-11-8-14-20(33(3)4)23(36)19(26(29)39)25(38)28(14,41)24(37)17(11)22(18)35/h5-6,9,11,14,17,19-20,34,41H,7-8,10H2,1-4H3,(H2,29,39)(H,30,40)/t11-,14-,17?,19?,20?,28-/m0/s1 |
| InChIKey | LEGCAKUJQKXVDB-PBUFFHNHSA-N |
| XLogP | -1.15 |
| TPSA | 213.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|