C31H37N7O4 — CID 10189475
N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-2-oxo-2-[[2-oxo-2-(2-phenylethylamino)ethyl]amino]-1-phenylethyl]amino]pentan-2-yl]benzamide (PubChem CID 10189475) has the molecular formula C31H37N7O4 and a molecular weight of 571.68 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-2-oxo-2-[[2-oxo-2-(2-phenylethylamino)ethyl]amino]-1-phenylethyl]amino]pentan-2-yl]benzamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-2-oxo-2-[[2-oxo-2-(2-phenylethylamino)ethyl]amino]-1-phenylethyl]amino]pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 10189475 |
| Molecular Formula | C31H37N7O4 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-2-oxo-2-[[2-oxo-2-(2-phenylethylamino)ethyl]amino]-1-phenylethyl]amino]pentan-2-yl]benzamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccccc1)C(=O)N[C@H](C(=O)NCC(=O)NCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H37N7O4/c32-31(33)35-19-10-17-25(37-28(40)24-15-8-3-9-16-24)29(41)38-27(23-13-6-2-7-14-23)30(42)36-21-26(39)34-20-18-22-11-4-1-5-12-22/h1-9,11-16,25,27H,10,17-21H2,(H,34,39)(H,36,42)(H,37,40)(H,38,41)(H4,32,33,35)/t25-,27-/m0/s1 |
| InChIKey | DJGIYGTZNXHZAX-BDYUSTAISA-N |
| XLogP | 1.17 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|