C22H30N2O4 — CID 10200175
[(1S,12S,14R)-4-ethyl-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N,N-diethylcarbamate (PubChem CID 10200175) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(1S,12S,14R)-4-ethyl-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N,N-diethylcarbamate.
| Compound Name | [(1S,12S,14R)-4-ethyl-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 10200175 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [(1S,12S,14R)-4-ethyl-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N,N-diethylcarbamate |
| SMILES | CCN1CC[C@@]23C=C[C@H](OC(=O)N(CC)CC)C[C@@H]2Oc2c(O)ccc(c23)C1 |
| InChI | InChI=1S/C22H30N2O4/c1-4-23-12-11-22-10-9-16(27-21(26)24(5-2)6-3)13-18(22)28-20-17(25)8-7-15(14-23)19(20)22/h7-10,16,18,25H,4-6,11-14H2,1-3H3/t16-,18-,22-/m0/s1 |
| InChIKey | VOMPZZCUZFKZER-ZJBJCVSYSA-N |
| XLogP | 3.42 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|