C21H23ClN2O — CID 102005348
N-butyl-3-(4-chlorophenyl)-4-(2-methylphenyl)-2,3-dihydroazete-2-carboxamide (PubChem CID 102005348) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N-butyl-3-(4-chlorophenyl)-4-(2-methylphenyl)-2,3-dihydroazete-2-carboxamide.
| Compound Name | N-butyl-3-(4-chlorophenyl)-4-(2-methylphenyl)-2,3-dihydroazete-2-carboxamide |
|---|---|
| PubChem CID | 102005348 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-butyl-3-(4-chlorophenyl)-4-(2-methylphenyl)-2,3-dihydroazete-2-carboxamide |
| SMILES | CCCCNC(=O)C1N=C(c2ccccc2C)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O/c1-3-4-13-23-21(25)20-18(15-9-11-16(22)12-10-15)19(24-20)17-8-6-5-7-14(17)2/h5-12,18,20H,3-4,13H2,1-2H3,(H,23,25) |
| InChIKey | GGWCQYCKSRSFJA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|