C20H20Cl2N2O — CID 102092813
(2R,3S)-N-butyl-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2,3-dihydroazete-2-carboxamide (PubChem CID 102092813) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is (2R,3S)-N-butyl-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2,3-dihydroazete-2-carboxamide.
| Compound Name | (2R,3S)-N-butyl-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2,3-dihydroazete-2-carboxamide |
|---|---|
| PubChem CID | 102092813 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2R,3S)-N-butyl-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2,3-dihydroazete-2-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1N=C(c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O/c1-2-3-11-23-20(25)19-17(13-7-9-15(21)10-8-13)18(24-19)14-5-4-6-16(22)12-14/h4-10,12,17,19H,2-3,11H2,1H3,(H,23,25)/t17-,19-/m1/s1 |
| InChIKey | UJONYZKBIYNVRA-IEBWSBKVSA-N |
| XLogP | 4.86 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|