C23H15O+ — CID 102006760
7,8-dihydropyren-7-ylium-1-yl(phenyl)methanone (PubChem CID 102006760) has the molecular formula C23H15O+ and a molecular weight of 307.37 g/mol. Its IUPAC name is 7,8-dihydropyren-7-ylium-1-yl(phenyl)methanone.
| Compound Name | 7,8-dihydropyren-7-ylium-1-yl(phenyl)methanone |
|---|---|
| PubChem CID | 102006760 |
| Molecular Formula | C23H15O+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 7,8-dihydropyren-7-ylium-1-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)c1ccc2ccc3c4c(ccc1c24)C[CH+]C=3 |
| InChI | InChI=1S/C23H15O/c24-23(18-5-2-1-3-6-18)20-14-12-17-10-9-15-7-4-8-16-11-13-19(20)22(17)21(15)16/h1-7,9-14H,8H2/q+1 |
| InChIKey | YWEOCDRUJFUGIH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|